C32H26Cl2N2O3S — CID 19581612
(5E)-3-benzyl-5-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 19581612) has the molecular formula C32H26Cl2N2O3S and a molecular weight of 589.54 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-benzyl-5-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19581612 |
| Molecular Formula | C32H26Cl2N2O3S |
| Molecular Weight | 589.54 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | (5E)-3-benzyl-5-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\C(=O)N(Cc3ccccc3)C(=S)N2c2ccccc2)c(Cl)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C32H26Cl2N2O3S/c1-2-38-29-18-24(27(34)19-30(29)39-21-23-13-9-10-16-26(23)33)17-28-31(37)35(20-22-11-5-3-6-12-22)32(40)36(28)25-14-7-4-8-15-25/h3-19H,2,20-21H2,1H3/b28-17+ |
| InChIKey | SQLWCVLQWRLMFW-OGLMXYFKSA-N |
| XLogP | 8.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|