C12H9BrN6O2S — CID 19587719
N-[(E)-(4-bromo-1-methylpyrazol-5-yl)methylideneamino]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 19587719) has the molecular formula C12H9BrN6O2S and a molecular weight of 381.22 g/mol. Its IUPAC name is N-[(E)-(4-bromo-1-methylpyrazol-5-yl)methylideneamino]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[(E)-(4-bromo-1-methylpyrazol-5-yl)methylideneamino]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 19587719 |
| Molecular Formula | C12H9BrN6O2S |
| Molecular Weight | 381.22 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | N-[(E)-(4-bromo-1-methylpyrazol-5-yl)methylideneamino]-3-thiophen-2-yl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | Cn1ncc(Br)c1/C=N/NC(=O)c1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C12H9BrN6O2S/c1-19-8(7(13)5-15-19)6-14-17-11(20)12-16-10(18-21-12)9-3-2-4-22-9/h2-6H,1H3,(H,17,20)/b14-6+ |
| InChIKey | BQPFDGVGQCLLPT-MKMNVTDBSA-N |
| XLogP | 2.06 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|