About 4-iodopyrimidin-5-ol
4-iodopyrimidin-5-ol (PubChem CID 19597629) has the molecular formula C4H3IN2O
and a molecular weight of 221.99 g/mol. Its IUPAC name is 4-iodopyrimidin-5-ol.
Molecular Properties
| Compound Name | 4-iodopyrimidin-5-ol |
| PubChem CID | 19597629 |
| Molecular Formula | C4H3IN2O |
| Molecular Weight | 221.99 g/mol |
| Exact Mass | 221.93 |
| IUPAC Name | 4-iodopyrimidin-5-ol |
| SMILES | Oc1cncnc1I |
| InChI | InChI=1S/C4H3IN2O/c5-4-3(8)1-6-2-7-4/h1-2,8H |
| InChIKey | UCCHCJWFSULSGU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.99 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodopyrimidin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodopyrimidin-5-ol?
The IUPAC name of 4-iodopyrimidin-5-ol (CID 19597629) is 4-iodopyrimidin-5-ol.
What is the SMILES notation for 4-iodopyrimidin-5-ol?
The canonical SMILES for 4-iodopyrimidin-5-ol is Oc1cncnc1I.
What is the InChIKey of 4-iodopyrimidin-5-ol?
The InChIKey is UCCHCJWFSULSGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3IN2O/c5-4-3(8)1-6-2-7-4/h1-2,8H.
What are the key properties of 4-iodopyrimidin-5-ol?
4-iodopyrimidin-5-ol has a molecular weight of 221.99 g/mol, XLogP of 0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodopyrimidin-5-ol is sourced from PubChem (CID 19597629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).