C15H11Cl3N2O4 — CID 19603134
2-hydroxy-2-(4-nitrophenyl)-N-(3,4,5-trichlorophenyl)propanamide (PubChem CID 19603134) has the molecular formula C15H11Cl3N2O4 and a molecular weight of 389.62 g/mol. Its IUPAC name is 2-hydroxy-2-(4-nitrophenyl)-N-(3,4,5-trichlorophenyl)propanamide.
| Compound Name | 2-hydroxy-2-(4-nitrophenyl)-N-(3,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 19603134 |
| Molecular Formula | C15H11Cl3N2O4 |
| Molecular Weight | 389.62 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 2-hydroxy-2-(4-nitrophenyl)-N-(3,4,5-trichlorophenyl)propanamide |
| SMILES | CC(O)(C(=O)Nc1cc(Cl)c(Cl)c(Cl)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11Cl3N2O4/c1-15(22,8-2-4-10(5-3-8)20(23)24)14(21)19-9-6-11(16)13(18)12(17)7-9/h2-7,22H,1H3,(H,19,21) |
| InChIKey | ABNCIVVJUUQVGG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|