C16H12Cl2N4O3 — CID 11417607
1-[1-cyano-1-(4-nitrophenyl)ethyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 11417607) has the molecular formula C16H12Cl2N4O3 and a molecular weight of 379.20 g/mol. Its IUPAC name is 1-[1-cyano-1-(4-nitrophenyl)ethyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[1-cyano-1-(4-nitrophenyl)ethyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 11417607 |
| Molecular Formula | C16H12Cl2N4O3 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 1-[1-cyano-1-(4-nitrophenyl)ethyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | CC(C#N)(NC(=O)Nc1ccc(Cl)c(Cl)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12Cl2N4O3/c1-16(9-19,10-2-5-12(6-3-10)22(24)25)21-15(23)20-11-4-7-13(17)14(18)8-11/h2-8H,1H3,(H2,20,21,23) |
| InChIKey | QDTVWEVOWBMKNG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|