C17H15N5O — CID 19699088
(4-aminophenyl)-(3,4,9,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-9-yl)methanone (PubChem CID 19699088) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is (4-aminophenyl)-(3,4,9,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-9-yl)methanone.
| Compound Name | (4-aminophenyl)-(3,4,9,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-9-yl)methanone |
|---|---|
| PubChem CID | 19699088 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (4-aminophenyl)-(3,4,9,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-9-yl)methanone |
| SMILES | Nc1ccc(C(=O)N2CCc3cn[nH]c3-c3ncccc32)cc1 |
| InChI | InChI=1S/C17H15N5O/c18-13-5-3-11(4-6-13)17(23)22-9-7-12-10-20-21-15(12)16-14(22)2-1-8-19-16/h1-6,8,10H,7,9,18H2,(H,20,21) |
| InChIKey | ICAMNESWEZOUKN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|