C24H23N3O6 — CID 19704511
ethyl 2-(2,9,16,23-tetraoxo-1,10,13-triazatetracyclo[13.8.0.03,8.017,22]tricosa-3,5,7,17,19,21-hexaen-13-yl)acetate (PubChem CID 19704511) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is ethyl 2-(2,9,16,23-tetraoxo-1,10,13-triazatetracyclo[13.8.0.03,8.017,22]tricosa-3,5,7,17,19,21-hexaen-13-yl)acetate.
| Compound Name | ethyl 2-(2,9,16,23-tetraoxo-1,10,13-triazatetracyclo[13.8.0.03,8.017,22]tricosa-3,5,7,17,19,21-hexaen-13-yl)acetate |
|---|---|
| PubChem CID | 19704511 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | ethyl 2-(2,9,16,23-tetraoxo-1,10,13-triazatetracyclo[13.8.0.03,8.017,22]tricosa-3,5,7,17,19,21-hexaen-13-yl)acetate |
| SMILES | CCOC(=O)CN1CCNC(=O)c2ccccc2C(=O)N2C(=O)c3ccccc3C(=O)C2C1 |
| InChI | InChI=1S/C24H23N3O6/c1-2-33-20(28)14-26-12-11-25-22(30)16-8-4-6-10-18(16)24(32)27-19(13-26)21(29)15-7-3-5-9-17(15)23(27)31/h3-10,19H,2,11-14H2,1H3,(H,25,30) |
| InChIKey | QDSMDTHYXNDWFS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|