C9H15N3O5 — CID 19708154
ethyl N-[3-(2,5-dioxoimidazolidin-4-yl)propoxy]carbamate (PubChem CID 19708154) has the molecular formula C9H15N3O5 and a molecular weight of 245.23 g/mol. Its IUPAC name is ethyl N-[3-(2,5-dioxoimidazolidin-4-yl)propoxy]carbamate.
| Compound Name | ethyl N-[3-(2,5-dioxoimidazolidin-4-yl)propoxy]carbamate |
|---|---|
| PubChem CID | 19708154 |
| Molecular Formula | C9H15N3O5 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | ethyl N-[3-(2,5-dioxoimidazolidin-4-yl)propoxy]carbamate |
| SMILES | CCOC(=O)NOCCCC1NC(=O)NC1=O |
| InChI | InChI=1S/C9H15N3O5/c1-2-16-9(15)12-17-5-3-4-6-7(13)11-8(14)10-6/h6H,2-5H2,1H3,(H,12,15)(H2,10,11,13,14) |
| InChIKey | JUXAGBWXWYCCFI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|