C10H14ClNO4S — CID 19733457
[2-(4-chlorophenoxy)-2-methylpropyl] sulfamate (PubChem CID 19733457) has the molecular formula C10H14ClNO4S and a molecular weight of 279.75 g/mol. Its IUPAC name is [2-(4-chlorophenoxy)-2-methylpropyl] sulfamate.
| Compound Name | [2-(4-chlorophenoxy)-2-methylpropyl] sulfamate |
|---|---|
| PubChem CID | 19733457 |
| Molecular Formula | C10H14ClNO4S |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | [2-(4-chlorophenoxy)-2-methylpropyl] sulfamate |
| SMILES | CC(C)(COS(N)(=O)=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H14ClNO4S/c1-10(2,7-15-17(12,13)14)16-9-5-3-8(11)4-6-9/h3-6H,7H2,1-2H3,(H2,12,13,14) |
| InChIKey | ZPDHDFBRUJYNRU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |