C10H19N2O5+ — CID 19736248
(3-carboxy-2-hydroxypropyl)-dimethyl-(propanoylcarbamoyl)azanium (PubChem CID 19736248) has the molecular formula C10H19N2O5+ and a molecular weight of 247.27 g/mol. Its IUPAC name is (3-carboxy-2-hydroxypropyl)-dimethyl-(propanoylcarbamoyl)azanium.
| Compound Name | (3-carboxy-2-hydroxypropyl)-dimethyl-(propanoylcarbamoyl)azanium |
|---|---|
| PubChem CID | 19736248 |
| Molecular Formula | C10H19N2O5+ |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (3-carboxy-2-hydroxypropyl)-dimethyl-(propanoylcarbamoyl)azanium |
| SMILES | CCC(=O)NC(=O)[N+](C)(C)CC(O)CC(=O)O |
| InChI | InChI=1S/C10H18N2O5/c1-4-8(14)11-10(17)12(2,3)6-7(13)5-9(15)16/h7,13H,4-6H2,1-3H3,(H-,11,14,15,16,17)/p+1 |
| InChIKey | YRBJPIOVLNHGLO-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|