C19H25ClN2O2S — CID 19743676
ethyl 4-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]butanoate (PubChem CID 19743676) has the molecular formula C19H25ClN2O2S and a molecular weight of 380.94 g/mol. Its IUPAC name is ethyl 4-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]butanoate.
| Compound Name | ethyl 4-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]butanoate |
|---|---|
| PubChem CID | 19743676 |
| Molecular Formula | C19H25ClN2O2S |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | ethyl 4-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]butanoate |
| SMILES | CCCSc1ncc(CCCC(=O)OCC)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C19H25ClN2O2S/c1-3-12-25-19-21-13-16(9-7-11-18(23)24-4-2)22(19)14-15-8-5-6-10-17(15)20/h5-6,8,10,13H,3-4,7,9,11-12,14H2,1-2H3 |
| InChIKey | AJFMZKQIIJZUBJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |