C23H24ClN3O3S — CID 15280951
2-benzamido-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoic acid (PubChem CID 15280951) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 2-benzamido-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoic acid.
| Compound Name | 2-benzamido-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 15280951 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-benzamido-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoic acid |
| SMILES | CCCSc1ncc(CC(NC(=O)c2ccccc2)C(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H24ClN3O3S/c1-2-12-31-23-25-14-18(27(23)15-17-10-6-7-11-19(17)24)13-20(22(29)30)26-21(28)16-8-4-3-5-9-16/h3-11,14,20H,2,12-13,15H2,1H3,(H,26,28)(H,29,30) |
| InChIKey | DKBNZFWWTGEUNI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |