C18H24ClN3O2S — CID 19351527
ethyl 2-amino-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoate (PubChem CID 19351527) has the molecular formula C18H24ClN3O2S and a molecular weight of 381.93 g/mol. Its IUPAC name is ethyl 2-amino-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoate.
| Compound Name | ethyl 2-amino-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 19351527 |
| Molecular Formula | C18H24ClN3O2S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | ethyl 2-amino-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoate |
| SMILES | CCCSc1ncc(CC(N)C(=O)OCC)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C18H24ClN3O2S/c1-3-9-25-18-21-11-14(10-16(20)17(23)24-4-2)22(18)12-13-7-5-6-8-15(13)19/h5-8,11,16H,3-4,9-10,12,20H2,1-2H3 |
| InChIKey | SNMDTASNXNIUDO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |