C16H20ClN3O2S — CID 67736944
2-amino-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoic acid (PubChem CID 67736944) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is 2-amino-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoic acid.
| Compound Name | 2-amino-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 67736944 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-amino-3-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl]propanoic acid |
| SMILES | CCCSc1ncc(CC(N)C(=O)O)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C16H20ClN3O2S/c1-2-7-23-16-19-9-12(8-14(18)15(21)22)20(16)10-11-5-3-4-6-13(11)17/h3-6,9,14H,2,7-8,10,18H2,1H3,(H,21,22) |
| InChIKey | LCZWNQAPNHRVIE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |