C25H35ClN2O4S — CID 54011763
1-O-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl] 3-O-ethyl 2-ethyl-2-pentylpropanedioate (PubChem CID 54011763) has the molecular formula C25H35ClN2O4S and a molecular weight of 495.09 g/mol. Its IUPAC name is 1-O-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl] 3-O-ethyl 2-ethyl-2-pentylpropanedioate.
| Compound Name | 1-O-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl] 3-O-ethyl 2-ethyl-2-pentylpropanedioate |
|---|---|
| PubChem CID | 54011763 |
| Molecular Formula | C25H35ClN2O4S |
| Molecular Weight | 495.09 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 1-O-[3-[(2-chlorophenyl)methyl]-2-propylsulfanylimidazol-4-yl] 3-O-ethyl 2-ethyl-2-pentylpropanedioate |
| SMILES | CCCCCC(CC)(C(=O)OCC)C(=O)Oc1cnc(SCCC)n1Cc1ccccc1Cl |
| InChI | InChI=1S/C25H35ClN2O4S/c1-5-9-12-15-25(7-3,22(29)31-8-4)23(30)32-21-17-27-24(33-16-6-2)28(21)18-19-13-10-11-14-20(19)26/h10-11,13-14,17H,5-9,12,15-16,18H2,1-4H3 |
| InChIKey | KSVYOHHYCPCYBU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.09 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|