C24H25N7S — CID 19750466
2-[1-cyclohexyl-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethanethial (PubChem CID 19750466) has the molecular formula C24H25N7S and a molecular weight of 443.58 g/mol. Its IUPAC name is 2-[1-cyclohexyl-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethanethial.
| Compound Name | 2-[1-cyclohexyl-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethanethial |
|---|---|
| PubChem CID | 19750466 |
| Molecular Formula | C24H25N7S |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 2-[1-cyclohexyl-5-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1,2,4-triazol-3-yl]ethanethial |
| SMILES | S=CCc1nc(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n(C2CCCCC2)n1 |
| InChI | InChI=1S/C24H25N7S/c32-15-14-22-25-23(31(28-22)19-6-2-1-3-7-19)16-17-10-12-18(13-11-17)20-8-4-5-9-21(20)24-26-29-30-27-24/h4-5,8-13,15,19H,1-3,6-7,14,16H2,(H,26,27,29,30) |
| InChIKey | QHVDHBROKAWBDF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|