C26H38N6O3S — CID 19764536
N-(3-aminopropyl)-2-[4-[2-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propyl]phenyl]sulfanylpropanamide (PubChem CID 19764536) has the molecular formula C26H38N6O3S and a molecular weight of 514.70 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[4-[2-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propyl]phenyl]sulfanylpropanamide.
| Compound Name | N-(3-aminopropyl)-2-[4-[2-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propyl]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19764536 |
| Molecular Formula | C26H38N6O3S |
| Molecular Weight | 514.70 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | N-(3-aminopropyl)-2-[4-[2-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)propyl]phenyl]sulfanylpropanamide |
| SMILES | CCCn1c(=O)c2[nH]c(C(C)Cc3ccc(SC(C)C(=O)NCCCN)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C26H38N6O3S/c1-5-14-31-23-21(25(34)32(15-6-2)26(31)35)29-22(30-23)17(3)16-19-8-10-20(11-9-19)36-18(4)24(33)28-13-7-12-27/h8-11,17-18H,5-7,12-16,27H2,1-4H3,(H,28,33)(H,29,30) |
| InChIKey | WGTIPHUUVMFPET-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.70 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|