C19H25N — CID 19767197
4-[1-(4-ethylcyclohexyl)but-3-enyl]benzonitrile (PubChem CID 19767197) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 4-[1-(4-ethylcyclohexyl)but-3-enyl]benzonitrile.
| Compound Name | 4-[1-(4-ethylcyclohexyl)but-3-enyl]benzonitrile |
|---|---|
| PubChem CID | 19767197 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 4-[1-(4-ethylcyclohexyl)but-3-enyl]benzonitrile |
| SMILES | C=CCC(c1ccc(C#N)cc1)C1CCC(CC)CC1 |
| InChI | InChI=1S/C19H25N/c1-3-5-19(17-10-6-15(4-2)7-11-17)18-12-8-16(14-20)9-13-18/h3,8-9,12-13,15,17,19H,1,4-7,10-11H2,2H3 |
| InChIKey | MOLKKHMZLLFGLW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|