About CID 19793852
CID 19793852 (PubChem CID 19793852) has the molecular formula C11H17F5OSi
and a molecular weight of 288.33 g/mol.
Molecular Properties
| Compound Name | CID 19793852 |
| PubChem CID | 19793852 |
| Molecular Formula | C11H17F5OSi |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OCCCCC(=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H17F5OSi/c1-10(2,3)18-17-7-5-4-6-8(9(12)13)11(14,15)16/h4-7H2,1-3H3 |
| InChIKey | KWDDFVCOVNKKHH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 19793852 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 19793852?
The IUPAC name of CID 19793852 (CID 19793852) is not available.
What is the SMILES notation for CID 19793852?
The canonical SMILES for CID 19793852 is CC(C)(C)[Si]OCCCCC(=C(F)F)C(F)(F)F.
What is the InChIKey of CID 19793852?
The InChIKey is KWDDFVCOVNKKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F5OSi/c1-10(2,3)18-17-7-5-4-6-8(9(12)13)11(14,15)16/h4-7H2,1-3H3.
What are the key properties of CID 19793852?
CID 19793852 has a molecular weight of 288.33 g/mol, XLogP of 4.72, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 19793852 is sourced from PubChem (CID 19793852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).