About dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-)
dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-) (PubChem CID 19795276) has the molecular formula C17H21F6SSb
and a molecular weight of 493.17 g/mol. Its IUPAC name is dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-).
Molecular Properties
| Compound Name | dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-) |
| PubChem CID | 19795276 |
| Molecular Formula | C17H21F6SSb |
| Molecular Weight | 493.17 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-) |
| SMILES | CC(C)[S+](Cc1ccccc1)Cc1ccccc1.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C17H21S.6FH.Sb/c1-15(2)18(13-16-9-5-3-6-10-16)14-17-11-7-4-8-12-17;;;;;;;/h3-12,15H,13-14H2,1-2H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | GFTBKLHIZFUDHO-UHFFFAOYSA-H |
| XLogP | 6.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.17 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-)?
The IUPAC name of dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-) (CID 19795276) is dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-).
What is the SMILES notation for dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-)?
The canonical SMILES for dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-) is CC(C)[S+](Cc1ccccc1)Cc1ccccc1.F[Sb-](F)(F)(F)(F)F.
What is the InChIKey of dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-)?
The InChIKey is GFTBKLHIZFUDHO-UHFFFAOYSA-H. The full InChI is InChI=1S/C17H21S.6FH.Sb/c1-15(2)18(13-16-9-5-3-6-10-16)14-17-11-7-4-8-12-17;;;;;;;/h3-12,15H,13-14H2,1-2H3;6*1H;/q+1;;;;;;;+5/p-6.
What are the key properties of dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-)?
dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-) has a molecular weight of 493.17 g/mol, XLogP of 6.55, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl(propan-2-yl)sulfanium;hexafluoroantimony(1-) is sourced from PubChem (CID 19795276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).