C9H8N2O — CID 19800206
3,4-dimethylpyrrolo[2,3-b]pyridin-2-one (PubChem CID 19800206) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 3,4-dimethylpyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 3,4-dimethylpyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 19800206 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 3,4-dimethylpyrrolo[2,3-b]pyridin-2-one |
| SMILES | CC1=c2c(C)ccnc2=NC1=O |
| InChI | InChI=1S/C9H8N2O/c1-5-3-4-10-8-7(5)6(2)9(12)11-8/h3-4H,1-2H3 |
| InChIKey | BELLALWTRYHPSE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |