About 5-fluoropyrrolo[2,3-b]pyridin-2-one
5-fluoropyrrolo[2,3-b]pyridin-2-one (PubChem CID 71772882) has the molecular formula C7H3FN2O
and a molecular weight of 150.11 g/mol. Its IUPAC name is 5-fluoropyrrolo[2,3-b]pyridin-2-one.
Molecular Properties
| Compound Name | 5-fluoropyrrolo[2,3-b]pyridin-2-one |
| PubChem CID | 71772882 |
| Molecular Formula | C7H3FN2O |
| Molecular Weight | 150.11 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | 5-fluoropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1C=c2cc(F)cnc2=N1 |
| InChI | InChI=1S/C7H3FN2O/c8-5-1-4-2-6(11)10-7(4)9-3-5/h1-3H |
| InChIKey | QKUJTYQVFGUMEV-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.11 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoropyrrolo[2,3-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoropyrrolo[2,3-b]pyridin-2-one?
The IUPAC name of 5-fluoropyrrolo[2,3-b]pyridin-2-one (CID 71772882) is 5-fluoropyrrolo[2,3-b]pyridin-2-one.
What is the SMILES notation for 5-fluoropyrrolo[2,3-b]pyridin-2-one?
The canonical SMILES for 5-fluoropyrrolo[2,3-b]pyridin-2-one is O=C1C=c2cc(F)cnc2=N1.
What is the InChIKey of 5-fluoropyrrolo[2,3-b]pyridin-2-one?
The InChIKey is QKUJTYQVFGUMEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3FN2O/c8-5-1-4-2-6(11)10-7(4)9-3-5/h1-3H.
What are the key properties of 5-fluoropyrrolo[2,3-b]pyridin-2-one?
5-fluoropyrrolo[2,3-b]pyridin-2-one has a molecular weight of 150.11 g/mol, XLogP of -0.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoropyrrolo[2,3-b]pyridin-2-one is sourced from PubChem (CID 71772882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).