C11H16N2O4 — CID 19814203
dimethyl 1-(cyanomethyl)piperidine-2,4-dicarboxylate (PubChem CID 19814203) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is dimethyl 1-(cyanomethyl)piperidine-2,4-dicarboxylate.
| Compound Name | dimethyl 1-(cyanomethyl)piperidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19814203 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | dimethyl 1-(cyanomethyl)piperidine-2,4-dicarboxylate |
| SMILES | COC(=O)C1CCN(CC#N)C(C(=O)OC)C1 |
| InChI | InChI=1S/C11H16N2O4/c1-16-10(14)8-3-5-13(6-4-12)9(7-8)11(15)17-2/h8-9H,3,5-7H2,1-2H3 |
| InChIKey | FVMZLVJCMMMUBY-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|