C22H26N2O7 — CID 19826068
N-benzyl-3-(5,6-dimethoxy-1,2-benzoxazol-3-yl)-N-methylpropan-1-amine;oxalic acid (PubChem CID 19826068) has the molecular formula C22H26N2O7 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-benzyl-3-(5,6-dimethoxy-1,2-benzoxazol-3-yl)-N-methylpropan-1-amine;oxalic acid.
| Compound Name | N-benzyl-3-(5,6-dimethoxy-1,2-benzoxazol-3-yl)-N-methylpropan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 19826068 |
| Molecular Formula | C22H26N2O7 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-benzyl-3-(5,6-dimethoxy-1,2-benzoxazol-3-yl)-N-methylpropan-1-amine;oxalic acid |
| SMILES | COc1cc2onc(CCCN(C)Cc3ccccc3)c2cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H24N2O3.C2H2O4/c1-22(14-15-8-5-4-6-9-15)11-7-10-17-16-12-19(23-2)20(24-3)13-18(16)25-21-17;3-1(4)2(5)6/h4-6,8-9,12-13H,7,10-11,14H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | BJTOMRQJHSOZPA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 122.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|