C20H23N3O2 — CID 19829512
5-(benzylamino)-2-[4-(methylamino)butyl]isoindole-1,3-dione (PubChem CID 19829512) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 5-(benzylamino)-2-[4-(methylamino)butyl]isoindole-1,3-dione.
| Compound Name | 5-(benzylamino)-2-[4-(methylamino)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19829512 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 5-(benzylamino)-2-[4-(methylamino)butyl]isoindole-1,3-dione |
| SMILES | CNCCCCN1C(=O)c2ccc(NCc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C20H23N3O2/c1-21-11-5-6-12-23-19(24)17-10-9-16(13-18(17)20(23)25)22-14-15-7-3-2-4-8-15/h2-4,7-10,13,21-22H,5-6,11-12,14H2,1H3 |
| InChIKey | VKTZVAASQLJXJS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|