C17H18N4O2 — CID 19832350
N-(2,4-diaminophenyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide (PubChem CID 19832350) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is N-(2,4-diaminophenyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide.
| Compound Name | N-(2,4-diaminophenyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 19832350 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(2,4-diaminophenyl)-3,3-dimethyl-2-oxo-1H-indole-6-carboxamide |
| SMILES | CC1(C)C(=O)Nc2cc(C(=O)Nc3ccc(N)cc3N)ccc21 |
| InChI | InChI=1S/C17H18N4O2/c1-17(2)11-5-3-9(7-14(11)21-16(17)23)15(22)20-13-6-4-10(18)8-12(13)19/h3-8H,18-19H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | HSRASQLBQPVYOS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|