C20H16ClF2NO3S — CID 19841300
ethyl 8-chloro-1-ethyl-6,7-difluoro-4-oxo-2-phenylsulfanylquinoline-3-carboxylate (PubChem CID 19841300) has the molecular formula C20H16ClF2NO3S and a molecular weight of 423.87 g/mol. Its IUPAC name is ethyl 8-chloro-1-ethyl-6,7-difluoro-4-oxo-2-phenylsulfanylquinoline-3-carboxylate.
| Compound Name | ethyl 8-chloro-1-ethyl-6,7-difluoro-4-oxo-2-phenylsulfanylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 19841300 |
| Molecular Formula | C20H16ClF2NO3S |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | ethyl 8-chloro-1-ethyl-6,7-difluoro-4-oxo-2-phenylsulfanylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(Sc2ccccc2)n(CC)c2c(Cl)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C20H16ClF2NO3S/c1-3-24-17-12(10-13(22)16(23)15(17)21)18(25)14(20(26)27-4-2)19(24)28-11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | GNSSNNZCZXQKLL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|