C13H21ClN2 — CID 19855600
2-N-(2-chloroethyl)-1-N-(2,6-dimethylphenyl)propane-1,2-diamine (PubChem CID 19855600) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is 2-N-(2-chloroethyl)-1-N-(2,6-dimethylphenyl)propane-1,2-diamine.
| Compound Name | 2-N-(2-chloroethyl)-1-N-(2,6-dimethylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 19855600 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-N-(2-chloroethyl)-1-N-(2,6-dimethylphenyl)propane-1,2-diamine |
| SMILES | Cc1cccc(C)c1NCC(C)NCCCl |
| InChI | InChI=1S/C13H21ClN2/c1-10-5-4-6-11(2)13(10)16-9-12(3)15-8-7-14/h4-6,12,15-16H,7-9H2,1-3H3 |
| InChIKey | CAYBYKRVRFPHDF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|