C14H11ClN4O7S — CID 19858132
4-[(4-chloro-3-sulfamoylbenzoyl)-nitramidoamino]benzoic acid (PubChem CID 19858132) has the molecular formula C14H11ClN4O7S and a molecular weight of 414.78 g/mol. Its IUPAC name is 4-[(4-chloro-3-sulfamoylbenzoyl)-nitramidoamino]benzoic acid.
| Compound Name | 4-[(4-chloro-3-sulfamoylbenzoyl)-nitramidoamino]benzoic acid |
|---|---|
| PubChem CID | 19858132 |
| Molecular Formula | C14H11ClN4O7S |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 4-[(4-chloro-3-sulfamoylbenzoyl)-nitramidoamino]benzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)N(N[N+](=O)[O-])c2ccc(C(=O)O)cc2)ccc1Cl |
| InChI | InChI=1S/C14H11ClN4O7S/c15-11-6-3-9(7-12(11)27(16,25)26)13(20)18(17-19(23)24)10-4-1-8(2-5-10)14(21)22/h1-7,17H,(H,21,22)(H2,16,25,26) |
| InChIKey | IPJUJZXORPMYJK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|