C20H36N2S — CID 19875510
1,1,3-tricyclohexyl-3-methylthiourea (PubChem CID 19875510) has the molecular formula C20H36N2S and a molecular weight of 336.59 g/mol. Its IUPAC name is 1,1,3-tricyclohexyl-3-methylthiourea.
| Compound Name | 1,1,3-tricyclohexyl-3-methylthiourea |
|---|---|
| PubChem CID | 19875510 |
| Molecular Formula | C20H36N2S |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 1,1,3-tricyclohexyl-3-methylthiourea |
| SMILES | CN(C(=S)N(C1CCCCC1)C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H36N2S/c1-21(17-11-5-2-6-12-17)20(23)22(18-13-7-3-8-14-18)19-15-9-4-10-16-19/h17-19H,2-16H2,1H3 |
| InChIKey | DCKUGBMHBROUQS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|