About 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one
4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one (PubChem CID 19887109) has the molecular formula C21H36O3
and a molecular weight of 336.52 g/mol. Its IUPAC name is 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one.
Molecular Properties
| Compound Name | 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one |
| PubChem CID | 19887109 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one |
| SMILES | CCCCCCCCCC/C=C/C1(C)OOC2CC1CC(=O)C2C |
| InChI | InChI=1S/C21H36O3/c1-4-5-6-7-8-9-10-11-12-13-14-21(3)18-15-19(22)17(2)20(16-18)23-24-21/h13-14,17-18,20H,4-12,15-16H2,1-3H3/b14-13+ |
| InChIKey | ZKACNOYSTNGFMV-BUHFOSPRSA-N |
| XLogP | 5.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one?
The IUPAC name of 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one (CID 19887109) is 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one.
What is the SMILES notation for 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one?
The canonical SMILES for 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one is CCCCCCCCCC/C=C/C1(C)OOC2CC1CC(=O)C2C.
What is the InChIKey of 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one?
The InChIKey is ZKACNOYSTNGFMV-BUHFOSPRSA-N. The full InChI is InChI=1S/C21H36O3/c1-4-5-6-7-8-9-10-11-12-13-14-21(3)18-15-19(22)17(2)20(16-18)23-24-21/h13-14,17-18,20H,4-12,15-16H2,1-3H3/b14-13+.
What are the key properties of 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one?
4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one has a molecular weight of 336.52 g/mol, XLogP of 5.78, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-dodec-1-enyl]-4,8-dimethyl-2,3-dioxabicyclo[3.3.1]nonan-7-one is sourced from PubChem (CID 19887109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).