C18H30O3 — CID 57005593
(1R,4S,5S,8R)-4,8-dimethyl-4-non-1-enyl-2,3-dioxabicyclo[3.3.1]nonan-7-one (PubChem CID 57005593) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1R,4S,5S,8R)-4,8-dimethyl-4-non-1-enyl-2,3-dioxabicyclo[3.3.1]nonan-7-one.
| Compound Name | (1R,4S,5S,8R)-4,8-dimethyl-4-non-1-enyl-2,3-dioxabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 57005593 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (1R,4S,5S,8R)-4,8-dimethyl-4-non-1-enyl-2,3-dioxabicyclo[3.3.1]nonan-7-one |
| SMILES | CCCCCCCC=C[C@@]1(C)OO[C@@H]2C[C@H]1CC(=O)[C@@H]2C |
| InChI | InChI=1S/C18H30O3/c1-4-5-6-7-8-9-10-11-18(3)15-12-16(19)14(2)17(13-15)20-21-18/h10-11,14-15,17H,4-9,12-13H2,1-3H3/t14-,15+,17+,18+/m0/s1 |
| InChIKey | BLEOHZNDUZQDAJ-BURFUSLBSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|