C20H30O6 — CID 19893091
4-[[2-(6-hydroxy-2-methylheptan-3-yl)-4-methyl-1,3-dioxolan-2-yl]oxy]-3-methoxybenzaldehyde (PubChem CID 19893091) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is 4-[[2-(6-hydroxy-2-methylheptan-3-yl)-4-methyl-1,3-dioxolan-2-yl]oxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[[2-(6-hydroxy-2-methylheptan-3-yl)-4-methyl-1,3-dioxolan-2-yl]oxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 19893091 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 4-[[2-(6-hydroxy-2-methylheptan-3-yl)-4-methyl-1,3-dioxolan-2-yl]oxy]-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OC1(C(CCC(C)O)C(C)C)OCC(C)O1 |
| InChI | InChI=1S/C20H30O6/c1-13(2)17(8-6-14(3)22)20(24-12-15(4)25-20)26-18-9-7-16(11-21)10-19(18)23-5/h7,9-11,13-15,17,22H,6,8,12H2,1-5H3 |
| InChIKey | GHFUAOJMIXVCEH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|