C12H15NO2 — CID 19894370
2-(3,5-dimethoxyphenyl)buta-2,3-dien-1-amine (PubChem CID 19894370) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)buta-2,3-dien-1-amine.
| Compound Name | 2-(3,5-dimethoxyphenyl)buta-2,3-dien-1-amine |
|---|---|
| PubChem CID | 19894370 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)buta-2,3-dien-1-amine |
| SMILES | C=C=C(CN)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C12H15NO2/c1-4-9(8-13)10-5-11(14-2)7-12(6-10)15-3/h5-7H,1,8,13H2,2-3H3 |
| InChIKey | RZUWCAMMFUTRIB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |