C19H15N5O4 — CID 19916129
methyl 11,13-dimethyl-4-(3-nitrophenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate (PubChem CID 19916129) has the molecular formula C19H15N5O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is methyl 11,13-dimethyl-4-(3-nitrophenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate.
| Compound Name | methyl 11,13-dimethyl-4-(3-nitrophenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate |
|---|---|
| PubChem CID | 19916129 |
| Molecular Formula | C19H15N5O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | methyl 11,13-dimethyl-4-(3-nitrophenyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaene-6-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc([N+](=O)[O-])c2)nc2c3c(C)cc(C)nc3nn12 |
| InChI | InChI=1S/C19H15N5O4/c1-10-7-11(2)20-17-16(10)18-21-14(9-15(19(25)28-3)23(18)22-17)12-5-4-6-13(8-12)24(26)27/h4-9H,1-3H3 |
| InChIKey | CPTJQZVEWLAPMJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|