C23H41NO3 — CID 19928719
2,6,10-trimethyl-12-(1-phenylethylamino)dodecane-2,6,10-triol (PubChem CID 19928719) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is 2,6,10-trimethyl-12-(1-phenylethylamino)dodecane-2,6,10-triol.
| Compound Name | 2,6,10-trimethyl-12-(1-phenylethylamino)dodecane-2,6,10-triol |
|---|---|
| PubChem CID | 19928719 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | 2,6,10-trimethyl-12-(1-phenylethylamino)dodecane-2,6,10-triol |
| SMILES | CC(NCCC(C)(O)CCCC(C)(O)CCCC(C)(C)O)c1ccccc1 |
| InChI | InChI=1S/C23H41NO3/c1-19(20-11-7-6-8-12-20)24-18-17-23(5,27)16-10-15-22(4,26)14-9-13-21(2,3)25/h6-8,11-12,19,24-27H,9-10,13-18H2,1-5H3 |
| InChIKey | CEMVQCFOOZSPHL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |