C21H22O7 — CID 19933328
methyl 3,8,9,10-tetramethoxy-1-methylanthracene-2-carboperoxoate (PubChem CID 19933328) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is methyl 3,8,9,10-tetramethoxy-1-methylanthracene-2-carboperoxoate.
| Compound Name | methyl 3,8,9,10-tetramethoxy-1-methylanthracene-2-carboperoxoate |
|---|---|
| PubChem CID | 19933328 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | methyl 3,8,9,10-tetramethoxy-1-methylanthracene-2-carboperoxoate |
| SMILES | COOC(=O)c1c(OC)cc2c(OC)c3cccc(OC)c3c(OC)c2c1C |
| InChI | InChI=1S/C21H22O7/c1-11-16-13(10-15(24-3)17(11)21(22)28-27-6)19(25-4)12-8-7-9-14(23-2)18(12)20(16)26-5/h7-10H,1-6H3 |
| InChIKey | CCRRUGPCRANVOV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|