C31H26F3NO3 — CID 19959529
4-[3-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]morpholine (PubChem CID 19959529) has the molecular formula C31H26F3NO3 and a molecular weight of 517.55 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]morpholine.
| Compound Name | 4-[3-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]morpholine |
|---|---|
| PubChem CID | 19959529 |
| Molecular Formula | C31H26F3NO3 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]benzo[f]chromen-6-yl]morpholine |
| SMILES | COc1ccc(C2(c3ccc(C(F)(F)F)cc3)C=Cc3c(cc(N4CCOCC4)c4ccccc34)O2)cc1 |
| InChI | InChI=1S/C31H26F3NO3/c1-36-24-12-10-22(11-13-24)30(21-6-8-23(9-7-21)31(32,33)34)15-14-27-25-4-2-3-5-26(25)28(20-29(27)38-30)35-16-18-37-19-17-35/h2-15,20H,16-19H2,1H3 |
| InChIKey | WINXDEAUMJFPFW-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|