About dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate
dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate (PubChem CID 19962810) has the molecular formula C21H27NO10S
and a molecular weight of 485.51 g/mol. Its IUPAC name is dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate.
Molecular Properties
| Compound Name | dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate |
| PubChem CID | 19962810 |
| Molecular Formula | C21H27NO10S |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[N+](C)(CCOC(=O)Oc1ccccc1)CCOC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H24NO6.CH4O4S/c1-21(2,13-15-24-19(22)26-17-9-5-3-6-10-17)14-16-25-20(23)27-18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | WTUHIBJPFOFODF-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 137.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate?
The IUPAC name of dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate (CID 19962810) is dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate.
What is the SMILES notation for dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate?
The canonical SMILES for dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate is COS(=O)(=O)[O-].C[N+](C)(CCOC(=O)Oc1ccccc1)CCOC(=O)Oc1ccccc1.
What is the InChIKey of dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate?
The InChIKey is WTUHIBJPFOFODF-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H24NO6.CH4O4S/c1-21(2,13-15-24-19(22)26-17-9-5-3-6-10-17)14-16-25-20(23)27-18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate?
dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate has a molecular weight of 485.51 g/mol, XLogP of 2.59, 9 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(2-phenoxycarbonyloxyethyl)azanium;methyl sulfate is sourced from PubChem (CID 19962810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).