C29H31N5O4 — CID 19972551
N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-(4-nitrophenyl)-1H-indole-7-carboxamide (PubChem CID 19972551) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-(4-nitrophenyl)-1H-indole-7-carboxamide.
| Compound Name | N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-(4-nitrophenyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 19972551 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | N-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propyl]-2-(4-nitrophenyl)-1H-indole-7-carboxamide |
| SMILES | COc1ccccc1N1CCN(CCCNC(=O)c2cccc3cc(-c4ccc([N+](=O)[O-])cc4)[nH]c23)CC1 |
| InChI | InChI=1S/C29H31N5O4/c1-38-27-9-3-2-8-26(27)33-18-16-32(17-19-33)15-5-14-30-29(35)24-7-4-6-22-20-25(31-28(22)24)21-10-12-23(13-11-21)34(36)37/h2-4,6-13,20,31H,5,14-19H2,1H3,(H,30,35) |
| InChIKey | SAANBVSJEFDGDC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 103.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|