C7H10F6O2 — CID 19981076
1,3-diethoxy-1,1,2,2,3,3-hexafluoropropane (PubChem CID 19981076) has the molecular formula C7H10F6O2 and a molecular weight of 240.14 g/mol. Its IUPAC name is 1,3-diethoxy-1,1,2,2,3,3-hexafluoropropane.
| Compound Name | 1,3-diethoxy-1,1,2,2,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 19981076 |
| Molecular Formula | C7H10F6O2 |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1,3-diethoxy-1,1,2,2,3,3-hexafluoropropane |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)OCC |
| InChI | InChI=1S/C7H10F6O2/c1-3-14-6(10,11)5(8,9)7(12,13)15-4-2/h3-4H2,1-2H3 |
| InChIKey | UXJZRQPTLLRCJK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|