C14H13N5O4S — CID 19981359
3-(6-oxopurin-2-yl)-4-propoxybenzenesulfonamide (PubChem CID 19981359) has the molecular formula C14H13N5O4S and a molecular weight of 347.36 g/mol. Its IUPAC name is 3-(6-oxopurin-2-yl)-4-propoxybenzenesulfonamide.
| Compound Name | 3-(6-oxopurin-2-yl)-4-propoxybenzenesulfonamide |
|---|---|
| PubChem CID | 19981359 |
| Molecular Formula | C14H13N5O4S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3-(6-oxopurin-2-yl)-4-propoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(N)(=O)=O)cc1C1=NC(=O)C2=NC=NC2=N1 |
| InChI | InChI=1S/C14H13N5O4S/c1-2-5-23-10-4-3-8(24(15,21)22)6-9(10)12-18-13-11(14(20)19-12)16-7-17-13/h3-4,6-7H,2,5H2,1H3,(H2,15,21,22) |
| InChIKey | JILBOHNYXUMESX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |