About 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one
5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one (PubChem CID 57165726) has the molecular formula C17H19N5O3S
and a molecular weight of 373.44 g/mol. Its IUPAC name is 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 57165726 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCOc1ccc(S(=O)C(C)(C)C)cc1C1=NC(=O)C2=NN=NC2=N1 |
| InChI | InChI=1S/C17H19N5O3S/c1-5-8-25-12-7-6-10(26(24)17(2,3)4)9-11(12)14-18-15-13(16(23)19-14)20-22-21-15/h6-7,9H,5,8H2,1-4H3 |
| InChIKey | DVWWLOLKJXOOQS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 105.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one (CID 57165726) is 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one is CCCOc1ccc(S(=O)C(C)(C)C)cc1C1=NC(=O)C2=NN=NC2=N1.
What is the InChIKey of 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one?
The InChIKey is DVWWLOLKJXOOQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N5O3S/c1-5-8-25-12-7-6-10(26(24)17(2,3)4)9-11(12)14-18-15-13(16(23)19-14)20-22-21-15/h6-7,9H,5,8H2,1-4H3.
What are the key properties of 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one?
5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one has a molecular weight of 373.44 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-tert-butylsulfinyl-2-propoxyphenyl)triazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 57165726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).