About 2-hydroxydocosanoate
2-hydroxydocosanoate (PubChem CID 22361325) has the molecular formula C22H43O3-
and a molecular weight of 355.58 g/mol. Its IUPAC name is 2-hydroxydocosanoate.
Molecular Properties
| Compound Name | 2-hydroxydocosanoate |
| PubChem CID | 22361325 |
| Molecular Formula | C22H43O3- |
| Molecular Weight | 355.58 g/mol |
| Exact Mass | 355.32 |
| IUPAC Name | 2-hydroxydocosanoate |
| SMILES | CCCCCCCCCCCCCCCCCCCCC(O)C(=O)[O-] |
| InChI | InChI=1S/C22H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)22(24)25/h21,23H,2-20H2,1H3,(H,24,25)/p-1 |
| InChIKey | RPGJJWLCCOPDAZ-UHFFFAOYSA-M |
| XLogP | 5.53 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxydocosanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxydocosanoate?
The IUPAC name of 2-hydroxydocosanoate (CID 22361325) is 2-hydroxydocosanoate.
What is the SMILES notation for 2-hydroxydocosanoate?
The canonical SMILES for 2-hydroxydocosanoate is CCCCCCCCCCCCCCCCCCCCC(O)C(=O)[O-].
What is the InChIKey of 2-hydroxydocosanoate?
The InChIKey is RPGJJWLCCOPDAZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)22(24)25/h21,23H,2-20H2,1H3,(H,24,25)/p-1.
What are the key properties of 2-hydroxydocosanoate?
2-hydroxydocosanoate has a molecular weight of 355.58 g/mol, XLogP of 5.53, 20 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxydocosanoate is sourced from PubChem (CID 22361325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).