About 2-nitrosohexan-1-ol
2-nitrosohexan-1-ol (PubChem CID 131969945) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 2-nitrosohexan-1-ol.
Molecular Properties
| Compound Name | 2-nitrosohexan-1-ol |
| PubChem CID | 131969945 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 2-nitrosohexan-1-ol |
| SMILES | CCCCC(CO)N=O |
| InChI | InChI=1S/C6H13NO2/c1-2-3-4-6(5-8)7-9/h6,8H,2-5H2,1H3 |
| InChIKey | PBSUVNGTRISYIH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-nitrosohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrosohexan-1-ol?
The IUPAC name of 2-nitrosohexan-1-ol (CID 131969945) is 2-nitrosohexan-1-ol.
What is the SMILES notation for 2-nitrosohexan-1-ol?
The canonical SMILES for 2-nitrosohexan-1-ol is CCCCC(CO)N=O.
What is the InChIKey of 2-nitrosohexan-1-ol?
The InChIKey is PBSUVNGTRISYIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-2-3-4-6(5-8)7-9/h6,8H,2-5H2,1H3.
What are the key properties of 2-nitrosohexan-1-ol?
2-nitrosohexan-1-ol has a molecular weight of 131.18 g/mol, XLogP of 1.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrosohexan-1-ol is sourced from PubChem (CID 131969945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).