C25H17ClO4 — CID 2009356
(2E)-6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(E)-3-phenylprop-2-enylidene]-1-benzofuran-3-one (PubChem CID 2009356) has the molecular formula C25H17ClO4 and a molecular weight of 416.86 g/mol. Its IUPAC name is (2E)-6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(E)-3-phenylprop-2-enylidene]-1-benzofuran-3-one.
| Compound Name | (2E)-6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(E)-3-phenylprop-2-enylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2009356 |
| Molecular Formula | C25H17ClO4 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (2E)-6-[2-(4-chlorophenyl)-2-oxoethoxy]-2-[(E)-3-phenylprop-2-enylidene]-1-benzofuran-3-one |
| SMILES | O=C(COc1ccc2c(c1)O/C(=C/C=C/c1ccccc1)C2=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H17ClO4/c26-19-11-9-18(10-12-19)22(27)16-29-20-13-14-21-24(15-20)30-23(25(21)28)8-4-7-17-5-2-1-3-6-17/h1-15H,16H2/b7-4+,23-8+ |
| InChIKey | ZBUFUFMFAJTBGN-GMPUIBMGSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|