C24H17FO3 — CID 2025171
(2Z)-6-[(2-fluorophenyl)methoxy]-2-[(E)-3-phenylprop-2-enylidene]-1-benzofuran-3-one (PubChem CID 2025171) has the molecular formula C24H17FO3 and a molecular weight of 372.40 g/mol. Its IUPAC name is (2Z)-6-[(2-fluorophenyl)methoxy]-2-[(E)-3-phenylprop-2-enylidene]-1-benzofuran-3-one.
| Compound Name | (2Z)-6-[(2-fluorophenyl)methoxy]-2-[(E)-3-phenylprop-2-enylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 2025171 |
| Molecular Formula | C24H17FO3 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (2Z)-6-[(2-fluorophenyl)methoxy]-2-[(E)-3-phenylprop-2-enylidene]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/C=C/c2ccccc2)Oc2cc(OCc3ccccc3F)ccc21 |
| InChI | InChI=1S/C24H17FO3/c25-21-11-5-4-10-18(21)16-27-19-13-14-20-23(15-19)28-22(24(20)26)12-6-9-17-7-2-1-3-8-17/h1-15H,16H2/b9-6+,22-12- |
| InChIKey | UPVWPUVPBCUBNS-YEJNLHJGSA-N |
| XLogP | 5.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|