C19H25N4+ — CID 2036482
3-butyl-N,5-diphenyl-2,4-dihydro-1H-1,3,5-triazin-5-ium-6-amine (PubChem CID 2036482) has the molecular formula C19H25N4+ and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-butyl-N,5-diphenyl-2,4-dihydro-1H-1,3,5-triazin-5-ium-6-amine.
| Compound Name | 3-butyl-N,5-diphenyl-2,4-dihydro-1H-1,3,5-triazin-5-ium-6-amine |
|---|---|
| PubChem CID | 2036482 |
| Molecular Formula | C19H25N4+ |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3-butyl-N,5-diphenyl-2,4-dihydro-1H-1,3,5-triazin-5-ium-6-amine |
| SMILES | CCCCN1CNC(Nc2ccccc2)=[N+](c2ccccc2)C1 |
| InChI | InChI=1S/C19H24N4/c1-2-3-14-22-15-20-19(21-17-10-6-4-7-11-17)23(16-22)18-12-8-5-9-13-18/h4-13H,2-3,14-16H2,1H3,(H,20,21)/p+1 |
| InChIKey | VFRQHWYAQVSUFU-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 30.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|