C20H20N4+2 — CID 170843022
N,2,4-triphenyl-1,3-dihydro-1,2,4-triazole-1,4-diium-5-amine (PubChem CID 170843022) has the molecular formula C20H20N4+2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N,2,4-triphenyl-1,3-dihydro-1,2,4-triazole-1,4-diium-5-amine.
| Compound Name | N,2,4-triphenyl-1,3-dihydro-1,2,4-triazole-1,4-diium-5-amine |
|---|---|
| PubChem CID | 170843022 |
| Molecular Formula | C20H20N4+2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N,2,4-triphenyl-1,3-dihydro-1,2,4-triazole-1,4-diium-5-amine |
| SMILES | c1ccc(NC2=[N+](c3ccccc3)CN(c3ccccc3)[NH2+]2)cc1 |
| InChI | InChI=1S/C20H18N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-15H,16H2,(H,21,22)/p+2 |
| InChIKey | PZJZKXQHZCCGQN-UHFFFAOYSA-P |
| XLogP | 2.75 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|