C16H15N2O2+ — CID 69079415
1,3-diphenyl-4,5-dihydroimidazol-1-ium-2-carboxylic acid (PubChem CID 69079415) has the molecular formula C16H15N2O2+ and a molecular weight of 267.31 g/mol. Its IUPAC name is 1,3-diphenyl-4,5-dihydroimidazol-1-ium-2-carboxylic acid.
| Compound Name | 1,3-diphenyl-4,5-dihydroimidazol-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 69079415 |
| Molecular Formula | C16H15N2O2+ |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1,3-diphenyl-4,5-dihydroimidazol-1-ium-2-carboxylic acid |
| SMILES | O=C(O)C1=[N+](c2ccccc2)CCN1c1ccccc1 |
| InChI | InChI=1S/C16H14N2O2/c19-16(20)15-17(13-7-3-1-4-8-13)11-12-18(15)14-9-5-2-6-10-14/h1-10H,11-12H2/p+1 |
| InChIKey | JYPBXCYUEJAQMZ-UHFFFAOYSA-O |
| XLogP | 2.33 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|